C14H12N4S — CID 13107859
2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline (PubChem CID 13107859) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline.
| Compound Name | 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 13107859 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]aniline |
| SMILES | Nc1ccccc1-c1nnc(-c2ccccc2N)s1 |
| InChI | InChI=1S/C14H12N4S/c15-11-7-3-1-5-9(11)13-17-18-14(19-13)10-6-2-4-8-12(10)16/h1-8H,15-16H2 |
| InChIKey | VNUXVYZUMFAYJK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|