C10H11N7S2 — CID 6869123
[(Z)-[(2-aminophenyl)-(5-amino-1,3,4-thiadiazol-2-yl)methylidene]amino]thiourea (PubChem CID 6869123) has the molecular formula C10H11N7S2 and a molecular weight of 293.38 g/mol. Its IUPAC name is [(Z)-[(2-aminophenyl)-(5-amino-1,3,4-thiadiazol-2-yl)methylidene]amino]thiourea.
| Compound Name | [(Z)-[(2-aminophenyl)-(5-amino-1,3,4-thiadiazol-2-yl)methylidene]amino]thiourea |
|---|---|
| PubChem CID | 6869123 |
| Molecular Formula | C10H11N7S2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | [(Z)-[(2-aminophenyl)-(5-amino-1,3,4-thiadiazol-2-yl)methylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C(\c1nnc(N)s1)c1ccccc1N |
| InChI | InChI=1S/C10H11N7S2/c11-6-4-2-1-3-5(6)7(14-16-9(12)18)8-15-17-10(13)19-8/h1-4H,11H2,(H2,13,17)(H3,12,16,18)/b14-7- |
| InChIKey | YEKRVJUOPRAOST-AUWJEWJLSA-N |
| XLogP | 0.29 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|