C15H19Cl2N3O — CID 43452603
6-[3-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]hexan-1-amine (PubChem CID 43452603) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is 6-[3-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]hexan-1-amine.
| Compound Name | 6-[3-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]hexan-1-amine |
|---|---|
| PubChem CID | 43452603 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 6-[3-[(2,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]hexan-1-amine |
| SMILES | NCCCCCCc1nc(Cc2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C15H19Cl2N3O/c16-12-7-6-11(13(17)10-12)9-14-19-15(21-20-14)5-3-1-2-4-8-18/h6-7,10H,1-5,8-9,18H2 |
| InChIKey | ZRKMKJYKPPCBEH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|