4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid

C14H16N2O3 — CID 43473610

IUPAC4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid
SMILESO=C(O)CCCNCc1coc(-c2ccccc2)n1
InChIInChI=1S/C14H16N2O3/c17-13(18)7-4-8-15-9-12-10-19-14(16-12)11-5-2-1-3-6-11/h1-3,5-6,10,15H,4,7-9H2,(H,17,18)
InChIKeyFDGUUPNEFOKVMS-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.30
Rot. Bonds7

About 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid

4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid (PubChem CID 43473610) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid.

Molecular Properties

Compound Name4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid
PubChem CID43473610
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Name4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid
SMILESO=C(O)CCCNCc1coc(-c2ccccc2)n1
InChIInChI=1S/C14H16N2O3/c17-13(18)7-4-8-15-9-12-10-19-14(16-12)11-5-2-1-3-6-11/h1-3,5-6,10,15H,4,7-9H2,(H,17,18)
InChIKeyFDGUUPNEFOKVMS-UHFFFAOYSA-N
XLogP2.30
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid?
The IUPAC name of 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid (CID 43473610) is 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid.
What is the SMILES notation for 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid?
The canonical SMILES for 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid is O=C(O)CCCNCc1coc(-c2ccccc2)n1.
What is the InChIKey of 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid?
The InChIKey is FDGUUPNEFOKVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c17-13(18)7-4-8-15-9-12-10-19-14(16-12)11-5-2-1-3-6-11/h1-3,5-6,10,15H,4,7-9H2,(H,17,18).
What are the key properties of 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid?
4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid has a molecular weight of 260.29 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-phenyl-1,3-oxazol-4-yl)methylamino]butanoic acid is sourced from PubChem (CID 43473610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).