C4H6N4O4S — CID 43476878
2,4-dioxo-1H-pyrimidine-5-sulfonohydrazide (PubChem CID 43476878) has the molecular formula C4H6N4O4S and a molecular weight of 206.18 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-5-sulfonohydrazide.
| Compound Name | 2,4-dioxo-1H-pyrimidine-5-sulfonohydrazide |
|---|---|
| PubChem CID | 43476878 |
| Molecular Formula | C4H6N4O4S |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-5-sulfonohydrazide |
| SMILES | NNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C4H6N4O4S/c5-8-13(11,12)2-1-6-4(10)7-3(2)9/h1,8H,5H2,(H2,6,7,9,10) |
| InChIKey | IEPVEYUKXUMSJF-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|