C14H9FN2O3 — CID 43478020
2-(3-fluorophenoxy)imidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 43478020) has the molecular formula C14H9FN2O3 and a molecular weight of 272.24 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)imidazo[1,2-a]pyridine-3-carboxylic acid.
| Compound Name | 2-(3-fluorophenoxy)imidazo[1,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 43478020 |
| Molecular Formula | C14H9FN2O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-(3-fluorophenoxy)imidazo[1,2-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(Oc2cccc(F)c2)nc2ccccn12 |
| InChI | InChI=1S/C14H9FN2O3/c15-9-4-3-5-10(8-9)20-13-12(14(18)19)17-7-2-1-6-11(17)16-13/h1-8H,(H,18,19) |
| InChIKey | GEXKEZOOZMJYSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |