C15H26N2O3S — CID 43478927
1-ethylsulfonyl-N-[4-(furan-2-yl)butan-2-yl]piperidin-4-amine (PubChem CID 43478927) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[4-(furan-2-yl)butan-2-yl]piperidin-4-amine.
| Compound Name | 1-ethylsulfonyl-N-[4-(furan-2-yl)butan-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 43478927 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-ethylsulfonyl-N-[4-(furan-2-yl)butan-2-yl]piperidin-4-amine |
| SMILES | CCS(=O)(=O)N1CCC(NC(C)CCc2ccco2)CC1 |
| InChI | InChI=1S/C15H26N2O3S/c1-3-21(18,19)17-10-8-14(9-11-17)16-13(2)6-7-15-5-4-12-20-15/h4-5,12-14,16H,3,6-11H2,1-2H3 |
| InChIKey | WOUOQISJSLPMKF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |