C16H17BrINO2 — CID 43485032
1-(2-bromo-4,5-dimethoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine (PubChem CID 43485032) has the molecular formula C16H17BrINO2 and a molecular weight of 462.13 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dimethoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(2-bromo-4,5-dimethoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43485032 |
| Molecular Formula | C16H17BrINO2 |
| Molecular Weight | 462.13 g/mol |
| Exact Mass | 460.95 |
| IUPAC Name | 1-(2-bromo-4,5-dimethoxyphenyl)-1-(4-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)cc1)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C16H17BrINO2/c1-19-16(10-4-6-11(18)7-5-10)12-8-14(20-2)15(21-3)9-13(12)17/h4-9,16,19H,1-3H3 |
| InChIKey | SLZSNTLRSKISNK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|