C16H15BrINO2 — CID 43486228
1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-(4-iodophenyl)-N-methylmethanamine (PubChem CID 43486228) has the molecular formula C16H15BrINO2 and a molecular weight of 460.11 g/mol. Its IUPAC name is 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-(4-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-(4-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43486228 |
| Molecular Formula | C16H15BrINO2 |
| Molecular Weight | 460.11 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | 1-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1-(4-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(I)cc1)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C16H15BrINO2/c1-19-16(10-2-4-11(18)5-3-10)12-8-14-15(9-13(12)17)21-7-6-20-14/h2-5,8-9,16,19H,6-7H2,1H3 |
| InChIKey | BJJLODLZIGHRRO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|