C11H16N4O3 — CID 43501386
5-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1H-pyrazin-2-one (PubChem CID 43501386) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1H-pyrazin-2-one.
| Compound Name | 5-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 43501386 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1H-pyrazin-2-one |
| SMILES | O=C(c1c[nH]c(=O)cn1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C11H16N4O3/c16-6-5-14-1-3-15(4-2-14)11(18)9-7-13-10(17)8-12-9/h7-8,16H,1-6H2,(H,13,17) |
| InChIKey | ZPAZUBGILVMAGG-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |