C14H25NO2S — CID 43511508
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1,1-dioxothian-4-amine (PubChem CID 43511508) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43511508 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-1,1-dioxothian-4-amine |
| SMILES | CC(NC1CCS(=O)(=O)CC1)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H25NO2S/c1-10(14-9-11-2-3-12(14)8-11)15-13-4-6-18(16,17)7-5-13/h10-15H,2-9H2,1H3 |
| InChIKey | FTQNOHZXOPWXQY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |