C13H25NO2S — CID 43614943
N-(2,6-dimethylcyclohexyl)-1,1-dioxothian-4-amine (PubChem CID 43614943) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2,6-dimethylcyclohexyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43614943 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-1,1-dioxothian-4-amine |
| SMILES | CC1CCCC(C)C1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H25NO2S/c1-10-4-3-5-11(2)13(10)14-12-6-8-17(15,16)9-7-12/h10-14H,3-9H2,1-2H3 |
| InChIKey | GJVOHTWLFNKINX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |