C13H18F2N2O2S — CID 43523505
3,4-difluoro-N-(1-piperidin-2-ylethyl)benzenesulfonamide (PubChem CID 43523505) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is 3,4-difluoro-N-(1-piperidin-2-ylethyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(1-piperidin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43523505 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3,4-difluoro-N-(1-piperidin-2-ylethyl)benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)c(F)c1)C1CCCCN1 |
| InChI | InChI=1S/C13H18F2N2O2S/c1-9(13-4-2-3-7-16-13)17-20(18,19)10-5-6-11(14)12(15)8-10/h5-6,8-9,13,16-17H,2-4,7H2,1H3 |
| InChIKey | HVYNZFGOWDTLRL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |