C10H16F3NO3 — CID 43529729
2,2-diethyl-4-oxo-4-(2,2,2-trifluoroethylamino)butanoic acid (PubChem CID 43529729) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2,2-diethyl-4-oxo-4-(2,2,2-trifluoroethylamino)butanoic acid.
| Compound Name | 2,2-diethyl-4-oxo-4-(2,2,2-trifluoroethylamino)butanoic acid |
|---|---|
| PubChem CID | 43529729 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,2-diethyl-4-oxo-4-(2,2,2-trifluoroethylamino)butanoic acid |
| SMILES | CCC(CC)(CC(=O)NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H16F3NO3/c1-3-9(4-2,8(16)17)5-7(15)14-6-10(11,12)13/h3-6H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | MZTUZIKFLXGCFA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |