C13H17N3O — CID 43542627
4-amino-2-(3,5-dimethylphenyl)-1,5-dimethylpyrazol-3-one (PubChem CID 43542627) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-amino-2-(3,5-dimethylphenyl)-1,5-dimethylpyrazol-3-one.
| Compound Name | 4-amino-2-(3,5-dimethylphenyl)-1,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 43542627 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-amino-2-(3,5-dimethylphenyl)-1,5-dimethylpyrazol-3-one |
| SMILES | Cc1cc(C)cc(-n2c(=O)c(N)c(C)n2C)c1 |
| InChI | InChI=1S/C13H17N3O/c1-8-5-9(2)7-11(6-8)16-13(17)12(14)10(3)15(16)4/h5-7H,14H2,1-4H3 |
| InChIKey | YAAOPOGVMJQNMY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |