About 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid
3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid (PubChem CID 25073338) has the molecular formula C11H13N3O4S
and a molecular weight of 283.31 g/mol. Its IUPAC name is 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid.
Molecular Properties
| Compound Name | 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid |
| PubChem CID | 25073338 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid |
| SMILES | Cc1c(N)c(=O)n(-c2cccc(S(=O)(=O)O)c2)n1C |
| InChI | InChI=1S/C11H13N3O4S/c1-7-10(12)11(15)14(13(7)2)8-4-3-5-9(6-8)19(16,17)18/h3-6H,12H2,1-2H3,(H,16,17,18) |
| InChIKey | ZLYXBHKAITWVNE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid?
The IUPAC name of 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid (CID 25073338) is 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid.
What is the SMILES notation for 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid?
The canonical SMILES for 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid is Cc1c(N)c(=O)n(-c2cccc(S(=O)(=O)O)c2)n1C.
What is the InChIKey of 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid?
The InChIKey is ZLYXBHKAITWVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O4S/c1-7-10(12)11(15)14(13(7)2)8-4-3-5-9(6-8)19(16,17)18/h3-6H,12H2,1-2H3,(H,16,17,18).
What are the key properties of 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid?
3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid has a molecular weight of 283.31 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-2,3-dimethyl-5-oxopyrazol-1-yl)benzenesulfonic acid is sourced from PubChem (CID 25073338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).