C10H11N3O4S — CID 88792171
3-(3-amino-5-methyl-4-oxo-3H-pyrazol-2-yl)benzenesulfonic acid (PubChem CID 88792171) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is 3-(3-amino-5-methyl-4-oxo-3H-pyrazol-2-yl)benzenesulfonic acid.
| Compound Name | 3-(3-amino-5-methyl-4-oxo-3H-pyrazol-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88792171 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-(3-amino-5-methyl-4-oxo-3H-pyrazol-2-yl)benzenesulfonic acid |
| SMILES | CC1=NN(c2cccc(S(=O)(=O)O)c2)C(N)C1=O |
| InChI | InChI=1S/C10H11N3O4S/c1-6-9(14)10(11)13(12-6)7-3-2-4-8(5-7)18(15,16)17/h2-5,10H,11H2,1H3,(H,15,16,17) |
| InChIKey | UKIRQIPZNJDGRM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|