C8H11N5O5S — CID 43545770
2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]acetamide (PubChem CID 43545770) has the molecular formula C8H11N5O5S and a molecular weight of 289.27 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 43545770 |
| Molecular Formula | C8H11N5O5S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]acetamide |
| SMILES | NNc1ccc(S(=O)(=O)NCC(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H11N5O5S/c9-8(14)4-11-19(17,18)7-2-1-5(12-10)3-6(7)13(15)16/h1-3,11-12H,4,10H2,(H2,9,14) |
| InChIKey | AUMCRYUJMPBYPF-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|