C9H13N5O6S — CID 83205612
2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]ethyl carbamate (PubChem CID 83205612) has the molecular formula C9H13N5O6S and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83205612 |
| Molecular Formula | C9H13N5O6S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[(4-hydrazinyl-2-nitrophenyl)sulfonylamino]ethyl carbamate |
| SMILES | NNc1ccc(S(=O)(=O)NCCOC(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H13N5O6S/c10-9(15)20-4-3-12-21(18,19)8-2-1-6(13-11)5-7(8)14(16)17/h1-2,5,12-13H,3-4,11H2,(H2,10,15) |
| InChIKey | IGRULEXNKHVKMJ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 179.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|