C17H21N3O — CID 43546852
N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenylcyclopentane-1-carboxamide (PubChem CID 43546852) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenylcyclopentane-1-carboxamide.
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 43546852 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-1-phenylcyclopentane-1-carboxamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H21N3O/c1-12-15(13(2)20-19-12)18-16(21)17(10-6-7-11-17)14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | QMVQUCKHPXUDHT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |