C11H10Br2N4O — CID 43548466
N-(2-amino-4,6-dibromophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 43548466) has the molecular formula C11H10Br2N4O and a molecular weight of 374.04 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43548466 |
| Molecular Formula | C11H10Br2N4O |
| Molecular Weight | 374.04 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2c(N)cc(Br)cc2Br)cn1 |
| InChI | InChI=1S/C11H10Br2N4O/c1-17-5-6(4-15-17)11(18)16-10-8(13)2-7(12)3-9(10)14/h2-5H,14H2,1H3,(H,16,18) |
| InChIKey | QMULRVHKQWUOAM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.04 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|