C10H14N4O2 — CID 43556262
5-(4-aminopiperidine-1-carbonyl)-1H-pyrazin-2-one (PubChem CID 43556262) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 5-(4-aminopiperidine-1-carbonyl)-1H-pyrazin-2-one.
| Compound Name | 5-(4-aminopiperidine-1-carbonyl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 43556262 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 5-(4-aminopiperidine-1-carbonyl)-1H-pyrazin-2-one |
| SMILES | NC1CCN(C(=O)c2c[nH]c(=O)cn2)CC1 |
| InChI | InChI=1S/C10H14N4O2/c11-7-1-3-14(4-2-7)10(16)8-5-13-9(15)6-12-8/h5-7H,1-4,11H2,(H,13,15) |
| InChIKey | VMTYAVBCZZWBPN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |