C10H12N4O2 — CID 43594248
N-(3-azabicyclo[3.1.0]hexan-6-yl)-6-oxo-1H-pyrazine-3-carboxamide (PubChem CID 43594248) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-yl)-6-oxo-1H-pyrazine-3-carboxamide.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-6-oxo-1H-pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 43594248 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-6-oxo-1H-pyrazine-3-carboxamide |
| SMILES | O=C(NC1C2CNCC21)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C10H12N4O2/c15-8-4-12-7(3-13-8)10(16)14-9-5-1-11-2-6(5)9/h3-6,9,11H,1-2H2,(H,13,15)(H,14,16) |
| InChIKey | AOCWCKYWOMYTPW-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |