C11H17N3O4S2 — CID 43556327
3-(4-aminopiperidin-1-yl)sulfonylbenzenesulfonamide (PubChem CID 43556327) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-(4-aminopiperidin-1-yl)sulfonylbenzenesulfonamide.
| Compound Name | 3-(4-aminopiperidin-1-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 43556327 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-(4-aminopiperidin-1-yl)sulfonylbenzenesulfonamide |
| SMILES | NC1CCN(S(=O)(=O)c2cccc(S(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C11H17N3O4S2/c12-9-4-6-14(7-5-9)20(17,18)11-3-1-2-10(8-11)19(13,15)16/h1-3,8-9H,4-7,12H2,(H2,13,15,16) |
| InChIKey | BAHRENAWKYFFIN-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |