About CID 43558668
CID 43558668 (PubChem CID 43558668) has the molecular formula C15H28N3O2
and a molecular weight of 282.41 g/mol.
Molecular Properties
| Compound Name | CID 43558668 |
| PubChem CID | 43558668 |
| Molecular Formula | C15H28N3O2 |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | — |
| SMILES | O=C(CCC1CCC[N]C1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C15H28N3O2/c19-15(5-4-14-3-1-6-16-13-14)17-7-2-8-18-9-11-20-12-10-18/h14H,1-13H2,(H,17,19) |
| InChIKey | WAOISRAORAPTBQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 43558668 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 43558668?
The IUPAC name of CID 43558668 (CID 43558668) is not available.
What is the SMILES notation for CID 43558668?
The canonical SMILES for CID 43558668 is O=C(CCC1CCC[N]C1)NCCCN1CCOCC1.
What is the InChIKey of CID 43558668?
The InChIKey is WAOISRAORAPTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N3O2/c19-15(5-4-14-3-1-6-16-13-14)17-7-2-8-18-9-11-20-12-10-18/h14H,1-13H2,(H,17,19).
What are the key properties of CID 43558668?
CID 43558668 has a molecular weight of 282.41 g/mol, XLogP of 0.62, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 43558668 is sourced from PubChem (CID 43558668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).