C13H26N2O — CID 43573917
2-[(4-ethylcyclohexyl)amino]-N,N-dimethylpropanamide (PubChem CID 43573917) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-[(4-ethylcyclohexyl)amino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(4-ethylcyclohexyl)amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43573917 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2-[(4-ethylcyclohexyl)amino]-N,N-dimethylpropanamide |
| SMILES | CCC1CCC(NC(C)C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O/c1-5-11-6-8-12(9-7-11)14-10(2)13(16)15(3)4/h10-12,14H,5-9H2,1-4H3 |
| InChIKey | RGEHPCNUUKGJRK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |