About (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide
(2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide (PubChem CID 92666114) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide.
Molecular Properties
| Compound Name | (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide |
| PubChem CID | 92666114 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide |
| SMILES | CC1CCC(N[C@H](C)C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H24N2O/c1-9-5-7-11(8-6-9)13-10(2)12(15)14(3)4/h9-11,13H,5-8H2,1-4H3/t9?,10-,11?/m1/s1 |
| InChIKey | ROGFVEZPTXZTLH-HSOILSAZSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide?
The IUPAC name of (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide (CID 92666114) is (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide.
What is the SMILES notation for (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide?
The canonical SMILES for (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide is CC1CCC(N[C@H](C)C(=O)N(C)C)CC1.
What is the InChIKey of (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide?
The InChIKey is ROGFVEZPTXZTLH-HSOILSAZSA-N. The full InChI is InChI=1S/C12H24N2O/c1-9-5-7-11(8-6-9)13-10(2)12(15)14(3)4/h9-11,13H,5-8H2,1-4H3/t9?,10-,11?/m1/s1.
What are the key properties of (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide?
(2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide has a molecular weight of 212.34 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,N-dimethyl-2-[(4-methylcyclohexyl)amino]propanamide is sourced from PubChem (CID 92666114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).