C13H18BrN3O3S — CID 43577772
1-(2-amino-4-bromophenyl)sulfonyl-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 43577772) has the molecular formula C13H18BrN3O3S and a molecular weight of 376.28 g/mol. Its IUPAC name is 1-(2-amino-4-bromophenyl)sulfonyl-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-4-bromophenyl)sulfonyl-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43577772 |
| Molecular Formula | C13H18BrN3O3S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 1-(2-amino-4-bromophenyl)sulfonyl-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1S(=O)(=O)c1ccc(Br)cc1N |
| InChI | InChI=1S/C13H18BrN3O3S/c1-16(2)13(18)11-4-3-7-17(11)21(19,20)12-6-5-9(14)8-10(12)15/h5-6,8,11H,3-4,7,15H2,1-2H3 |
| InChIKey | KGSJRWFCUGFRPE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|