C8H16N2O5S — CID 43588555
2-[[2-(dimethylamino)-2-oxoethyl]-ethylsulfamoyl]acetic acid (PubChem CID 43588555) has the molecular formula C8H16N2O5S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-2-oxoethyl]-ethylsulfamoyl]acetic acid.
| Compound Name | 2-[[2-(dimethylamino)-2-oxoethyl]-ethylsulfamoyl]acetic acid |
|---|---|
| PubChem CID | 43588555 |
| Molecular Formula | C8H16N2O5S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[[2-(dimethylamino)-2-oxoethyl]-ethylsulfamoyl]acetic acid |
| SMILES | CCN(CC(=O)N(C)C)S(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C8H16N2O5S/c1-4-10(5-7(11)9(2)3)16(14,15)6-8(12)13/h4-6H2,1-3H3,(H,12,13) |
| InChIKey | RUYAJUKLTSUKBL-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |