C12H22N2O11S — CID 172704468
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonic acid (PubChem CID 172704468) has the molecular formula C12H22N2O11S and a molecular weight of 402.38 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonic acid |
|---|---|
| PubChem CID | 172704468 |
| Molecular Formula | C12H22N2O11S |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C2H6O3S/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2-6(3,4)5/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);2H2,1H3,(H,3,4,5) |
| InChIKey | DKAGJACMYBFRIR-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 210.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|