About N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine
N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43591372) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 43591372 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCOCCNC1=NCC(c2ccccc2)S1 |
| InChI | InChI=1S/C13H18N2OS/c1-2-16-9-8-14-13-15-10-12(17-13)11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,14,15) |
| InChIKey | QUSBHWOXRNJJJP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine (CID 43591372) is N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine is CCOCCNC1=NCC(c2ccccc2)S1.
What is the InChIKey of N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is QUSBHWOXRNJJJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-2-16-9-8-14-13-15-10-12(17-13)11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,14,15).
What are the key properties of N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine?
N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 250.37 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-5-phenyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 43591372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).