About (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide
(5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide (PubChem CID 70964527) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide |
| PubChem CID | 70964527 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1=NC[C@@H](c2ccccc2)S1 |
| InChI | InChI=1S/C14H18N2OS/c1-14(2,3)16-12(17)13-15-9-11(18-13)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | MIOBMYBKFVGSQY-NSHDSACASA-N |
| XLogP | 2.79 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide?
The IUPAC name of (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide (CID 70964527) is (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide.
What is the SMILES notation for (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide?
The canonical SMILES for (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide is CC(C)(C)NC(=O)C1=NC[C@@H](c2ccccc2)S1.
What is the InChIKey of (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide?
The InChIKey is MIOBMYBKFVGSQY-NSHDSACASA-N. The full InChI is InChI=1S/C14H18N2OS/c1-14(2,3)16-12(17)13-15-9-11(18-13)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,16,17)/t11-/m0/s1.
What are the key properties of (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide?
(5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide has a molecular weight of 262.38 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N-tert-butyl-5-phenyl-4,5-dihydro-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 70964527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).