C14H21FN4O2 — CID 43592111
3-fluoro-N'-hydroxy-4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzenecarboximidamide (PubChem CID 43592111) has the molecular formula C14H21FN4O2 and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 43592111 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]benzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(CN2CCN(CCO)CC2)c(F)c1 |
| InChI | InChI=1S/C14H21FN4O2/c15-13-9-11(14(16)17-21)1-2-12(13)10-19-5-3-18(4-6-19)7-8-20/h1-2,9,20-21H,3-8,10H2,(H2,16,17) |
| InChIKey | UPWDXWPPQPFDBO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|