C12H16N4O2 — CID 43595368
5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrazin-2-one (PubChem CID 43595368) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrazin-2-one.
| Compound Name | 5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 43595368 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)-1H-pyrazin-2-one |
| SMILES | CC1CC2CNCC2N1C(=O)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C12H16N4O2/c1-7-2-8-3-13-5-10(8)16(7)12(18)9-4-15-11(17)6-14-9/h4,6-8,10,13H,2-3,5H2,1H3,(H,15,17) |
| InChIKey | VYKGJXLDJOJBBB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |