C10H16N4O2 — CID 43596296
N-[3-(cyclopropylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 43596296) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N-[3-(cyclopropylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 43596296 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-[3-(cyclopropylamino)propyl]-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | O=C(NCCCNC1CC1)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N4O2/c15-9(8-6-13-10(16)14-8)12-5-1-4-11-7-2-3-7/h6-7,11H,1-5H2,(H,12,15)(H2,13,14,16) |
| InChIKey | AWKZPDMLVJESHS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|