C11H23N5O — CID 143405365
N-(3-aminopropyl)-2-methyl-5-(propylamino)-2,3-dihydro-1H-imidazole-4-carboxamide (PubChem CID 143405365) has the molecular formula C11H23N5O and a molecular weight of 241.34 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-methyl-5-(propylamino)-2,3-dihydro-1H-imidazole-4-carboxamide.
| Compound Name | N-(3-aminopropyl)-2-methyl-5-(propylamino)-2,3-dihydro-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 143405365 |
| Molecular Formula | C11H23N5O |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | N-(3-aminopropyl)-2-methyl-5-(propylamino)-2,3-dihydro-1H-imidazole-4-carboxamide |
| SMILES | CCCNC1=C(C(=O)NCCCN)NC(C)N1 |
| InChI | InChI=1S/C11H23N5O/c1-3-6-13-10-9(15-8(2)16-10)11(17)14-7-4-5-12/h8,13,15-16H,3-7,12H2,1-2H3,(H,14,17) |
| InChIKey | FVADVJCUSLXTHY-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|