C13H21N3O4S — CID 43604677
N-(3-amino-4-methoxyphenyl)-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 43604677) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2,6-dimethylmorpholine-4-sulfonamide.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2,6-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 43604677 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)N2CC(C)OC(C)C2)cc1N |
| InChI | InChI=1S/C13H21N3O4S/c1-9-7-16(8-10(2)20-9)21(17,18)15-11-4-5-13(19-3)12(14)6-11/h4-6,9-10,15H,7-8,14H2,1-3H3 |
| InChIKey | SHAOYDHAYGNEBQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|