C8H16F3N3O2S — CID 43607074
1,1,1-trifluoro-N-(3-piperazin-1-ylpropyl)methanesulfonamide (PubChem CID 43607074) has the molecular formula C8H16F3N3O2S and a molecular weight of 275.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(3-piperazin-1-ylpropyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(3-piperazin-1-ylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 43607074 |
| Molecular Formula | C8H16F3N3O2S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1,1,1-trifluoro-N-(3-piperazin-1-ylpropyl)methanesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O2S/c9-8(10,11)17(15,16)13-2-1-5-14-6-3-12-4-7-14/h12-13H,1-7H2 |
| InChIKey | YZSFBLNPPROUTP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|