C13H19NO2 — CID 43608875
3-(3,4-dimethylphenoxy)oxan-4-amine (PubChem CID 43608875) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(3,4-dimethylphenoxy)oxan-4-amine.
| Compound Name | 3-(3,4-dimethylphenoxy)oxan-4-amine |
|---|---|
| PubChem CID | 43608875 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-(3,4-dimethylphenoxy)oxan-4-amine |
| SMILES | Cc1ccc(OC2COCCC2N)cc1C |
| InChI | InChI=1S/C13H19NO2/c1-9-3-4-11(7-10(9)2)16-13-8-15-6-5-12(13)14/h3-4,7,12-13H,5-6,8,14H2,1-2H3 |
| InChIKey | WHOFNHVIMJTZDC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |