C12H16O2 — CID 164664143
2-(3,4-dimethylphenoxy)cyclobutan-1-ol (PubChem CID 164664143) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)cyclobutan-1-ol.
| Compound Name | 2-(3,4-dimethylphenoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 164664143 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)cyclobutan-1-ol |
| SMILES | Cc1ccc(OC2CCC2O)cc1C |
| InChI | InChI=1S/C12H16O2/c1-8-3-4-10(7-9(8)2)14-12-6-5-11(12)13/h3-4,7,11-13H,5-6H2,1-2H3 |
| InChIKey | WLYAQKZETGQWBO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |