C14H19NO3 — CID 70545504
[(3R,4R)-4-(3,4-dimethylphenoxy)pyrrolidin-3-yl] acetate (PubChem CID 70545504) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is [(3R,4R)-4-(3,4-dimethylphenoxy)pyrrolidin-3-yl] acetate.
| Compound Name | [(3R,4R)-4-(3,4-dimethylphenoxy)pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 70545504 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [(3R,4R)-4-(3,4-dimethylphenoxy)pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CNC[C@H]1Oc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H19NO3/c1-9-4-5-12(6-10(9)2)18-14-8-15-7-13(14)17-11(3)16/h4-6,13-15H,7-8H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | FZKFEDHKGAUVSD-ZIAGYGMSSA-N |
| XLogP | 1.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |