C13H20N2O — CID 43611627
3-[(3-ethylmorpholin-4-yl)methyl]aniline (PubChem CID 43611627) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-[(3-ethylmorpholin-4-yl)methyl]aniline.
| Compound Name | 3-[(3-ethylmorpholin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 43611627 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-[(3-ethylmorpholin-4-yl)methyl]aniline |
| SMILES | CCC1COCCN1Cc1cccc(N)c1 |
| InChI | InChI=1S/C13H20N2O/c1-2-13-10-16-7-6-15(13)9-11-4-3-5-12(14)8-11/h3-5,8,13H,2,6-7,9-10,14H2,1H3 |
| InChIKey | WRIUEDPAGKVZJB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|