C19H27N3O — CID 99948939
(3S)-3-(2-methylpropyl)-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]morpholine (PubChem CID 99948939) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (3S)-3-(2-methylpropyl)-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]morpholine.
| Compound Name | (3S)-3-(2-methylpropyl)-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 99948939 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (3S)-3-(2-methylpropyl)-4-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]morpholine |
| SMILES | CC(C)C[C@H]1COCCN1Cc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C19H27N3O/c1-16(2)11-19-15-23-10-9-21(19)13-17-5-3-6-18(12-17)14-22-8-4-7-20-22/h3-8,12,16,19H,9-11,13-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | NQIHXCQBPFZUKR-IBGZPJMESA-N |
| XLogP | 3.18 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |