C14H20FN3O2 — CID 43612167
N-(2-amino-5-fluorophenyl)-2-(3-ethylmorpholin-4-yl)acetamide (PubChem CID 43612167) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-(3-ethylmorpholin-4-yl)acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-(3-ethylmorpholin-4-yl)acetamide |
|---|---|
| PubChem CID | 43612167 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-(3-ethylmorpholin-4-yl)acetamide |
| SMILES | CCC1COCCN1CC(=O)Nc1cc(F)ccc1N |
| InChI | InChI=1S/C14H20FN3O2/c1-2-11-9-20-6-5-18(11)8-14(19)17-13-7-10(15)3-4-12(13)16/h3-4,7,11H,2,5-6,8-9,16H2,1H3,(H,17,19) |
| InChIKey | BEBNMGJBUVNJKJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|