C14H19FN4O2 — CID 63602687
N-(2-amino-5-fluorophenyl)-2-(2-ethyl-3-oxopiperazin-1-yl)acetamide (PubChem CID 63602687) has the molecular formula C14H19FN4O2 and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-(2-ethyl-3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-(2-ethyl-3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 63602687 |
| Molecular Formula | C14H19FN4O2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-(2-ethyl-3-oxopiperazin-1-yl)acetamide |
| SMILES | CCC1C(=O)NCCN1CC(=O)Nc1cc(F)ccc1N |
| InChI | InChI=1S/C14H19FN4O2/c1-2-12-14(21)17-5-6-19(12)8-13(20)18-11-7-9(15)3-4-10(11)16/h3-4,7,12H,2,5-6,8,16H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | SLQWCAXQMVDKTH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|