C8H10O4S — CID 43617356
3-(2-hydroxyethylsulfanylmethyl)furan-2-carboxylic acid (PubChem CID 43617356) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanylmethyl)furan-2-carboxylic acid.
| Compound Name | 3-(2-hydroxyethylsulfanylmethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43617356 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 3-(2-hydroxyethylsulfanylmethyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1occc1CSCCO |
| InChI | InChI=1S/C8H10O4S/c9-2-4-13-5-6-1-3-12-7(6)8(10)11/h1,3,9H,2,4-5H2,(H,10,11) |
| InChIKey | BDJFMXMPVBSCDB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|