C11H13FN2O2S2 — CID 43620070
3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-fluorobenzenecarbothioamide (PubChem CID 43620070) has the molecular formula C11H13FN2O2S2 and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-fluorobenzenecarbothioamide.
| Compound Name | 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 43620070 |
| Molecular Formula | C11H13FN2O2S2 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(F)c(CN2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C11H13FN2O2S2/c12-10-3-2-8(11(13)17)6-9(10)7-14-4-1-5-18(14,15)16/h2-3,6H,1,4-5,7H2,(H2,13,17) |
| InChIKey | PHNYVOAXJKXURF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|