C13H16N4O3S — CID 43620885
5-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid (PubChem CID 43620885) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 5-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 43620885 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(CSc2nnnn2C2CCCC2)oc1C(=O)O |
| InChI | InChI=1S/C13H16N4O3S/c1-8-6-10(20-11(8)12(18)19)7-21-13-14-15-16-17(13)9-4-2-3-5-9/h6,9H,2-5,7H2,1H3,(H,18,19) |
| InChIKey | JMPCLBUVSWFLCH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |