C15H13NO4 — CID 43625930
2-methyl-5-[(3-oxo-1H-isoindol-2-yl)methyl]furan-3-carboxylic acid (PubChem CID 43625930) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-methyl-5-[(3-oxo-1H-isoindol-2-yl)methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[(3-oxo-1H-isoindol-2-yl)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 43625930 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-methyl-5-[(3-oxo-1H-isoindol-2-yl)methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CN2Cc3ccccc3C2=O)cc1C(=O)O |
| InChI | InChI=1S/C15H13NO4/c1-9-13(15(18)19)6-11(20-9)8-16-7-10-4-2-3-5-12(10)14(16)17/h2-6H,7-8H2,1H3,(H,18,19) |
| InChIKey | FSLOGDDYKGCBKP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |