C14H14O3S — CID 43626586
(4,5-dimethoxy-2-methylphenyl)-thiophen-3-ylmethanone (PubChem CID 43626586) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)-thiophen-3-ylmethanone.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 43626586 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)-thiophen-3-ylmethanone |
| SMILES | COc1cc(C)c(C(=O)c2ccsc2)cc1OC |
| InChI | InChI=1S/C14H14O3S/c1-9-6-12(16-2)13(17-3)7-11(9)14(15)10-4-5-18-8-10/h4-8H,1-3H3 |
| InChIKey | HMOOKLIYMVPCHP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |